Can one find a natural number N in less than O(log(N))O(log(N))O(log(N)) time if one is allowed to ask whether any given integer is ≤≤leqN?
List Bloc QA Latest Questions
What is the dynamic pricing algorithm used by jet.com and is it really profitable in a long term?
How do I implement algorithms after watching Andrew Ng’s ML course as he does not (or very less) implement the algorithms in any programming language?
Can you make an artificial neural network that learns to imitate hash algorithms like MD5 just by using the results of their application, not algorithms?
How do I solve this string constraint problem?
Why is it difficult to perform a binary search on a linked list?
How can 100 determine the number of comparisons in “Binary Search”?
How are the keys of encryption and decryption algorithms securely shared between the sender and the receiver without being interrupted by intruders?
In Polyflow, what’s the algorithm in the mixing task?
Is it worth changing my career to data science, after 6 years of experience in performance and automation testing?
Can an algorithm have complexity of the order O([n])? Where [.] is a box function or integer function.
How do I get a job at Google by doing competitive programming (algorithms) or by focusing my energy on development ML projects, etc.?
How does an algorithm work?
What pre requisites do I need before learning data structure?
What are the algorithms used for mapping reads to a reference genome?
As a programmer, how often do you feel you are taking a lot of time to implement a seemingly simple algorithm?
Why do software engineers need to know algorithms?
How does one implement a binary tree using a linked list?
When does the Fuzzy C-Means algorithm become K-Means?
How many times will the following cases be executed: 1) for (I=m; I