Where can I find data structure info and conversion pseudocodes for image/sound/video formats?

How can I solve this Newton’s Method theory problem?

Where do I get data structures multiple choice question bank?

How do I learn to implement machine learning algorithms?

Does a local search algorithm pick the best option on each iteration?

What should I do if I failed to solve the dynamic programming questions and failed 4 programming interviews?

Which is the best algorithm for photo stacking of images?

How can I find a number of ways to represent any number as the addition of n numbers?

How do you match the same addresses written in different ways? Example: 45, Srinagar 190001 and 190001, Srinagar, 45.

What is the most common way to implement division algorithms in modern GPU?

Can one find a natural number N in less than O(log(N))O(log(N))O(log(N)) time if one is allowed to ask whether any given integer is ≤≤leqN?

What is the dynamic pricing algorithm used by jet.com and is it really profitable in a long term?

How do I implement algorithms after watching Andrew Ng’s ML course as he does not (or very less) implement the algorithms in any programming language?

What software should I develop using data structures in C++, as a beginner with average skills?

How do you write a banker’s algorithm with pseudo-code?

The IT sector is depleting, so should I head towards artificial intelligence or continue to specialise in data structures and algorithms without doing M.Tech?

What is the best algorithm to find prime numbers? What is its syntax?

In industry, how often is the Lempel-Ziv-Welch compression algorithm used?

Where can I get an algorithm for blind source localization for MATLAB, using beamforming?

What is the best PDF for learning computing algorithms?