Should I learn web development or algorithms on my vacation?
List Bloc QA Latest Questions
Can one find a natural number N in less than O(log(N))O(log(N))O(log(N)) time if one is allowed to ask whether any given integer is ≤≤leqN?
Why couldn’t anyone break the “DES cipher algorithm” till now?
How do I implement algorithms after watching Andrew Ng’s ML course as he does not (or very less) implement the algorithms in any programming language?
Is there an open source artificial intelligence (AI) better than Siri or Cortana?
When does the Fuzzy C-Means algorithm become K-Means?
Is it worth changing my career to data science, after 6 years of experience in performance and automation testing?
How many times will the following cases be executed: 1) for (I=m; I
How do I get a job at Google by doing competitive programming (algorithms) or by focusing my energy on development ML projects, etc.?
What are some examples of past stock algorithms that worked (even if they don’t necessarily work anymore)?
What pre requisites do I need before learning data structure?
How can I determine active fuel length (L) for triangular arrays and square arrays to calculate core power density?
As a programmer, how often do you feel you are taking a lot of time to implement a seemingly simple algorithm?
How do you find a combination of values with a bigger sum but closest to a target?
How does one implement a binary tree using a linked list?
Can you make an artificial neural network that learns to imitate hash algorithms like MD5 just by using the results of their application, not algorithms?
How do I solve this string constraint problem?
Can an algorithm have complexity of the order O([n])? Where [.] is a box function or integer function.
Why is it difficult to perform a binary search on a linked list?
How does an algorithm work?