Can you write a query to find the n-nearest neighbours in Mongo DB?

What is the relationship of the entropy between the parent node and the child node of the decision tree?

What are the best ways to combine deep learning with ensemble learning (best algorithms) with a microarray high dimensional data set?

How does the Snappy algorithm work?

How do I match profiles in a social network’s data graph (Facebook & Twitter) using a graph matching algorithm?

Could you please send the code of fit algorithms using turn-around time?

If I have an array made up of strings of digits and dashes, how can I use Javascript to add the sum of each digit while skipping the dashes?

Why is this code snippet O(log(n))?

What makes this algorithm O(log(n))O(log(n))O(log(n))?

When should I start learning data structure and algorithms?

What is the LDA face recognition algorithm?

What can be an intuitive explanation of Manacher’s algorithm?

How do I count the number of closed binary operations that are commutative?

Did John Cage ever compose using computer algorithms?

Can you be good at programming but bad at algorithms?

How can I get a MATLAB source code for STING and CLIQUE grid clustering algorithms?

What is the ML algorithm behind the image background removal in MS Powerpoint?

How can I find anyone in Bangalore who can help me with DS and Algo for the next few days?

What is the easiest way to calculate the time complexity of an algorithm?

What is the best way to explain this recursive method in Java?