How can I perfect myself with computer algorithms?
List Bloc QA Latest Questions
What makes this algorithm O(log(n))O(log(n))O(log(n))?
How do I initialize a variable with array?
How do social networks generate chronological feeds for each user?
Which searching algorithm is used in WhatsApp for finding a word in a chat?
SupportExpert
Is there some kind of computer vision algorithm that can select the most distant images from many images (inverse pb of near duplicate detection)?
What are the advantages of SVM algorithms?
Why can’t Kruskal’s algorithm be used for directed graphs?
SupportExpert
Do institutional algorithmic traders need to have strong understanding of market microstructure?
SupportExpert
Do I have to be good at solving and implementing algorithms before I can dive into machine learning?
Why is there no course in data structure and algorithm in Unacademy?
SupportExpert
Given that n! = 2,432,902,008,176,640,000, How do we find n? Is there a function for this?
What are the principles of Spherical K-means algorithm?
Which data structure is most suitable for a postfix expression?
How do I find best clustering algorithm with dataset size used and efficiency?
What algorithm and technology is Articoolo using?